C31H46N8O6 — CID 162737149
butyl N-[9-[[4-[[4-[2-[(2-aminooxyacetyl)amino]ethyl]piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-8-oxo-7H-purin-6-yl]carbamate (PubChem CID 162737149) has the molecular formula C31H46N8O6 and a molecular weight of 626.76 g/mol. Its IUPAC name is butyl N-[9-[[4-[[4-[2-[(2-aminooxyacetyl)amino]ethyl]piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-8-oxo-7H-purin-6-yl]carbamate.
| Compound Name | butyl N-[9-[[4-[[4-[2-[(2-aminooxyacetyl)amino]ethyl]piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-8-oxo-7H-purin-6-yl]carbamate |
|---|---|
| PubChem CID | 162737149 |
| Molecular Formula | C31H46N8O6 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | butyl N-[9-[[4-[[4-[2-[(2-aminooxyacetyl)amino]ethyl]piperidin-1-yl]methyl]phenyl]methyl]-2-butoxy-8-oxo-7H-purin-6-yl]carbamate |
| SMILES | CCCCOC(=O)Nc1nc(OCCCC)nc2c1[nH]c(=O)n2Cc1ccc(CN2CCC(CCNC(=O)CON)CC2)cc1 |
| InChI | InChI=1S/C31H46N8O6/c1-3-5-17-43-29-35-27(36-31(42)44-18-6-4-2)26-28(37-29)39(30(41)34-26)20-24-9-7-23(8-10-24)19-38-15-12-22(13-16-38)11-14-33-25(40)21-45-32/h7-10,22H,3-6,11-21,32H2,1-2H3,(H,33,40)(H,34,41)(H,35,36,37,42) |
| InChIKey | ITFVXHKVIAVHQJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 178.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|