C32H42N8O4 — CID 162390747
4-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]-3-methoxybenzamide (PubChem CID 162390747) has the molecular formula C32H42N8O4 and a molecular weight of 602.74 g/mol. Its IUPAC name is 4-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]-3-methoxybenzamide.
| Compound Name | 4-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 162390747 |
| Molecular Formula | C32H42N8O4 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | 4-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]-3-methoxybenzamide |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCC(CCNC(=O)c5ccc(N)c(OC)c5)CC4)cc3)c2n1 |
| InChI | InChI=1S/C32H42N8O4/c1-3-4-17-44-31-37-28(34)27-29(38-31)40(32(42)36-27)20-23-7-5-22(6-8-23)19-39-15-12-21(13-16-39)11-14-35-30(41)24-9-10-25(33)26(18-24)43-2/h5-10,18,21H,3-4,11-17,19-20,33H2,1-2H3,(H,35,41)(H,36,42)(H2,34,37,38) |
| InChIKey | RSFYVCXOORNPSU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|