C33H47N9O3 — CID 162737219
2-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]acetamide;4-methylaniline (PubChem CID 162737219) has the molecular formula C33H47N9O3 and a molecular weight of 617.80 g/mol. Its IUPAC name is 2-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]acetamide;4-methylaniline.
| Compound Name | 2-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]acetamide;4-methylaniline |
|---|---|
| PubChem CID | 162737219 |
| Molecular Formula | C33H47N9O3 |
| Molecular Weight | 617.80 g/mol |
| Exact Mass | 617.38 |
| IUPAC Name | 2-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]acetamide;4-methylaniline |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCC(CCNC(=O)CN)CC4)cc3)c2n1.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C26H38N8O3.C7H9N/c1-2-3-14-37-25-31-23(28)22-24(32-25)34(26(36)30-22)17-20-6-4-19(5-7-20)16-33-12-9-18(10-13-33)8-11-29-21(35)15-27;1-6-2-4-7(8)5-3-6/h4-7,18H,2-3,8-17,27H2,1H3,(H,29,35)(H,30,36)(H2,28,31,32);2-5H,8H2,1H3 |
| InChIKey | ARSBADMVNJGUSE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 183.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|