C32H52N10O5 — CID 162737260
2-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]acetamide;2-aminooxy-N-butylacetamide (PubChem CID 162737260) has the molecular formula C32H52N10O5 and a molecular weight of 656.83 g/mol. Its IUPAC name is 2-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]acetamide;2-aminooxy-N-butylacetamide.
| Compound Name | 2-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]acetamide;2-aminooxy-N-butylacetamide |
|---|---|
| PubChem CID | 162737260 |
| Molecular Formula | C32H52N10O5 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.41 |
| IUPAC Name | 2-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]acetamide;2-aminooxy-N-butylacetamide |
| SMILES | CCCCNC(=O)CON.CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCC(CCNC(=O)CN)CC4)cc3)c2n1 |
| InChI | InChI=1S/C26H38N8O3.C6H14N2O2/c1-2-3-14-37-25-31-23(28)22-24(32-25)34(26(36)30-22)17-20-6-4-19(5-7-20)16-33-12-9-18(10-13-33)8-11-29-21(35)15-27;1-2-3-4-8-6(9)5-10-7/h4-7,18H,2-3,8-17,27H2,1H3,(H,29,35)(H,30,36)(H2,28,31,32);2-5,7H2,1H3,(H,8,9) |
| InChIKey | GJYRYWJSFHHSRA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 221.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|