C29H38N10O3 — CID 162737193
5-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]pyrazine-2-carboxamide (PubChem CID 162737193) has the molecular formula C29H38N10O3 and a molecular weight of 574.69 g/mol. Its IUPAC name is 5-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]pyrazine-2-carboxamide.
| Compound Name | 5-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 162737193 |
| Molecular Formula | C29H38N10O3 |
| Molecular Weight | 574.69 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | 5-amino-N-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethyl]pyrazine-2-carboxamide |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCC(CCNC(=O)c5cnc(N)cn5)CC4)cc3)c2n1 |
| InChI | InChI=1S/C29H38N10O3/c1-2-3-14-42-28-36-25(31)24-26(37-28)39(29(41)35-24)18-21-6-4-20(5-7-21)17-38-12-9-19(10-13-38)8-11-32-27(40)22-15-34-23(30)16-33-22/h4-7,15-16,19H,2-3,8-14,17-18H2,1H3,(H2,30,34)(H,32,40)(H,35,41)(H2,31,36,37) |
| InChIKey | VXABQFPODWTDBT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 182.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|