C33H45N8O7P — CID 169002253
[4-[(2S)-2-amino-3-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethylamino]-3-oxopropyl]phenyl] dihydrogen phosphate (PubChem CID 169002253) has the molecular formula C33H45N8O7P and a molecular weight of 696.75 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethylamino]-3-oxopropyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[(2S)-2-amino-3-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethylamino]-3-oxopropyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 169002253 |
| Molecular Formula | C33H45N8O7P |
| Molecular Weight | 696.75 g/mol |
| Exact Mass | 696.31 |
| IUPAC Name | [4-[(2S)-2-amino-3-[2-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]ethylamino]-3-oxopropyl]phenyl] dihydrogen phosphate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCC(CCNC(=O)[C@@H](N)Cc5ccc(OP(=O)(O)O)cc5)CC4)cc3)c2n1 |
| InChI | InChI=1S/C33H45N8O7P/c1-2-3-18-47-32-38-29(35)28-30(39-32)41(33(43)37-28)21-25-6-4-24(5-7-25)20-40-16-13-22(14-17-40)12-15-36-31(42)27(34)19-23-8-10-26(11-9-23)48-49(44,45)46/h4-11,22,27H,2-3,12-21,34H2,1H3,(H,36,42)(H,37,43)(H2,35,38,39)(H2,44,45,46)/t27-/m0/s1 |
| InChIKey | CHYZGMLARLPLPF-MHZLTWQESA-N |
| XLogP | 2.69 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.75 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|