C29H43N7O4 — CID 175438234
tert-butyl N-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]-N-ethylcarbamate (PubChem CID 175438234) has the molecular formula C29H43N7O4 and a molecular weight of 553.71 g/mol. Its IUPAC name is tert-butyl N-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 175438234 |
| Molecular Formula | C29H43N7O4 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | tert-butyl N-[1-[[4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]phenyl]methyl]piperidin-4-yl]-N-ethylcarbamate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN4CCC(N(CC)C(=O)OC(C)(C)C)CC4)cc3)c2n1 |
| InChI | InChI=1S/C29H43N7O4/c1-6-8-17-39-26-32-24(30)23-25(33-26)36(27(37)31-23)19-21-11-9-20(10-12-21)18-34-15-13-22(14-16-34)35(7-2)28(38)40-29(3,4)5/h9-12,22H,6-8,13-19H2,1-5H3,(H,31,37)(H2,30,32,33) |
| InChIKey | DBAKSKMPIAYWOU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|