C21H27N7O4 — CID 59382500
1-[5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-2-pyridinyl]piperidine-4-carboxylic acid (PubChem CID 59382500) has the molecular formula C21H27N7O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 1-[5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-2-pyridinyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-2-pyridinyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 59382500 |
| Molecular Formula | C21H27N7O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 1-[5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-2-pyridinyl]piperidine-4-carboxylic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(N4CCC(C(=O)O)CC4)nc3)c2n1 |
| InChI | InChI=1S/C21H27N7O4/c1-2-3-10-32-20-25-17(22)16-18(26-20)28(21(31)24-16)12-13-4-5-15(23-11-13)27-8-6-14(7-9-27)19(29)30/h4-5,11,14H,2-3,6-10,12H2,1H3,(H,24,31)(H,29,30)(H2,22,25,26) |
| InChIKey | REYGIQCALAKYJX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 152.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|