C17H20N6O3S — CID 87330156
S-methyl 5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carbothioate (PubChem CID 87330156) has the molecular formula C17H20N6O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is S-methyl 5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carbothioate.
| Compound Name | S-methyl 5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carbothioate |
|---|---|
| PubChem CID | 87330156 |
| Molecular Formula | C17H20N6O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | S-methyl 5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carbothioate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(C(=O)SC)nc3)c2n1 |
| InChI | InChI=1S/C17H20N6O3S/c1-3-4-7-26-16-21-13(18)12-14(22-16)23(17(25)20-12)9-10-5-6-11(19-8-10)15(24)27-2/h5-6,8H,3-4,7,9H2,1-2H3,(H,20,25)(H2,18,21,22) |
| InChIKey | VHHYXKCPWYNOTE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|