C19H24N6O4 — CID 67263343
propan-2-yl 5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carboxylate (PubChem CID 67263343) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is propan-2-yl 5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carboxylate.
| Compound Name | propan-2-yl 5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 67263343 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | propan-2-yl 5-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]pyridine-2-carboxylate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(C(=O)OC(C)C)nc3)c2n1 |
| InChI | InChI=1S/C19H24N6O4/c1-4-5-8-28-18-23-15(20)14-16(24-18)25(19(27)22-14)10-12-6-7-13(21-9-12)17(26)29-11(2)3/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,22,27)(H2,20,23,24) |
| InChIKey | NJUSVQGZDDZEHA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|