C21H29N7O4 — CID 163263432
4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-N-[2-(2-aminoethoxy)ethyl]benzamide (PubChem CID 163263432) has the molecular formula C21H29N7O4 and a molecular weight of 443.51 g/mol. Its IUPAC name is 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-N-[2-(2-aminoethoxy)ethyl]benzamide.
| Compound Name | 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-N-[2-(2-aminoethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 163263432 |
| Molecular Formula | C21H29N7O4 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 4-[(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)methyl]-N-[2-(2-aminoethoxy)ethyl]benzamide |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(C(=O)NCCOCCN)cc3)c2n1 |
| InChI | InChI=1S/C21H29N7O4/c1-2-3-10-32-20-26-17(23)16-18(27-20)28(21(30)25-16)13-14-4-6-15(7-5-14)19(29)24-9-12-31-11-8-22/h4-7H,2-3,8-13,22H2,1H3,(H,24,29)(H,25,30)(H2,23,26,27) |
| InChIKey | JPYRRYJNKRDXKN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|