C20H27N6O8P — CID 71230502
2-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoyl]amino]ethyl ethyl hydrogen phosphate (PubChem CID 71230502) has the molecular formula C20H27N6O8P and a molecular weight of 510.44 g/mol. Its IUPAC name is 2-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoyl]amino]ethyl ethyl hydrogen phosphate.
| Compound Name | 2-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoyl]amino]ethyl ethyl hydrogen phosphate |
|---|---|
| PubChem CID | 71230502 |
| Molecular Formula | C20H27N6O8P |
| Molecular Weight | 510.44 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 2-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoyl]amino]ethyl ethyl hydrogen phosphate |
| SMILES | CCOP(=O)(O)OCCNC(=O)c1ccc(Cn2c(=O)[nH]c3c(N)nc(OCCOC)nc32)cc1 |
| InChI | InChI=1S/C20H27N6O8P/c1-3-33-35(29,30)34-9-8-22-18(27)14-6-4-13(5-7-14)12-26-17-15(23-20(26)28)16(21)24-19(25-17)32-11-10-31-2/h4-7H,3,8-12H2,1-2H3,(H,22,27)(H,23,28)(H,29,30)(H2,21,24,25) |
| InChIKey | NUBXDWJGXITGCY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 192.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|