C21H29N6O8P — CID 123453355
2-[[4-[(6-amino-2-methyl-8-oxo-7H-purin-9-yl)methyl]benzoyl]amino]ethyl 2,3-dimethoxypropyl hydrogen phosphate (PubChem CID 123453355) has the molecular formula C21H29N6O8P and a molecular weight of 524.47 g/mol. Its IUPAC name is 2-[[4-[(6-amino-2-methyl-8-oxo-7H-purin-9-yl)methyl]benzoyl]amino]ethyl 2,3-dimethoxypropyl hydrogen phosphate.
| Compound Name | 2-[[4-[(6-amino-2-methyl-8-oxo-7H-purin-9-yl)methyl]benzoyl]amino]ethyl 2,3-dimethoxypropyl hydrogen phosphate |
|---|---|
| PubChem CID | 123453355 |
| Molecular Formula | C21H29N6O8P |
| Molecular Weight | 524.47 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 2-[[4-[(6-amino-2-methyl-8-oxo-7H-purin-9-yl)methyl]benzoyl]amino]ethyl 2,3-dimethoxypropyl hydrogen phosphate |
| SMILES | COCC(COP(=O)(O)OCCNC(=O)c1ccc(Cn2c(=O)[nH]c3c(N)nc(C)nc32)cc1)OC |
| InChI | InChI=1S/C21H29N6O8P/c1-13-24-18(22)17-19(25-13)27(21(29)26-17)10-14-4-6-15(7-5-14)20(28)23-8-9-34-36(30,31)35-12-16(33-3)11-32-2/h4-7,16H,8-12H2,1-3H3,(H,23,28)(H,26,29)(H,30,31)(H2,22,24,25) |
| InChIKey | DKJGJAREBOXKDH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 192.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.47 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|