C18H22N6O3 — CID 67263447
methyl 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]benzoate (PubChem CID 67263447) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]benzoate.
| Compound Name | methyl 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]benzoate |
|---|---|
| PubChem CID | 67263447 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | methyl 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]benzoate |
| SMILES | CCCCNc1nc(N)c2[nH]c(=O)n(Cc3ccc(C(=O)OC)cc3)c2n1 |
| InChI | InChI=1S/C18H22N6O3/c1-3-4-9-20-17-22-14(19)13-15(23-17)24(18(26)21-13)10-11-5-7-12(8-6-11)16(25)27-2/h5-8H,3-4,9-10H2,1-2H3,(H,21,26)(H3,19,20,22,23) |
| InChIKey | XNWMEYTUCIWKFR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|