C30H50N10O2 — CID 122591537
4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]-N-[3-[4-[3-(propylamino)propylamino]butylamino]propyl]benzamide (PubChem CID 122591537) has the molecular formula C30H50N10O2 and a molecular weight of 582.80 g/mol. Its IUPAC name is 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]-N-[3-[4-[3-(propylamino)propylamino]butylamino]propyl]benzamide.
| Compound Name | 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]-N-[3-[4-[3-(propylamino)propylamino]butylamino]propyl]benzamide |
|---|---|
| PubChem CID | 122591537 |
| Molecular Formula | C30H50N10O2 |
| Molecular Weight | 582.80 g/mol |
| Exact Mass | 582.41 |
| IUPAC Name | 4-[[6-amino-2-(butylamino)-8-oxo-7H-purin-9-yl]methyl]-N-[3-[4-[3-(propylamino)propylamino]butylamino]propyl]benzamide |
| SMILES | CCCCNc1nc(N)c2[nH]c(=O)n(Cc3ccc(C(=O)NCCCNCCCCNCCCNCCC)cc3)c2n1 |
| InChI | InChI=1S/C30H50N10O2/c1-3-5-20-36-29-38-26(31)25-27(39-29)40(30(42)37-25)22-23-10-12-24(13-11-23)28(41)35-21-9-19-34-16-7-6-15-33-18-8-17-32-14-4-2/h10-13,32-34H,3-9,14-22H2,1-2H3,(H,35,41)(H,37,42)(H3,31,36,38,39) |
| InChIKey | MQUTYAXPARCYFA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 166.81 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.80 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|