C20H22N6O — CID 11646237
6-amino-2-(butylamino)-9-(naphthalen-2-ylmethyl)-7H-purin-8-one (PubChem CID 11646237) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 6-amino-2-(butylamino)-9-(naphthalen-2-ylmethyl)-7H-purin-8-one.
| Compound Name | 6-amino-2-(butylamino)-9-(naphthalen-2-ylmethyl)-7H-purin-8-one |
|---|---|
| PubChem CID | 11646237 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 6-amino-2-(butylamino)-9-(naphthalen-2-ylmethyl)-7H-purin-8-one |
| SMILES | CCCCNc1nc(N)c2[nH]c(=O)n(Cc3ccc4ccccc4c3)c2n1 |
| InChI | InChI=1S/C20H22N6O/c1-2-3-10-22-19-24-17(21)16-18(25-19)26(20(27)23-16)12-13-8-9-14-6-4-5-7-15(14)11-13/h4-9,11H,2-3,10,12H2,1H3,(H,23,27)(H3,21,22,24,25) |
| InChIKey | BSTHAZHPGQKHBM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|