C28H32N12O4 — CID 160881281
6-amino-9-benzyl-2-(2-hydroxyethylamino)-7H-purin-8-one (PubChem CID 160881281) has the molecular formula C28H32N12O4 and a molecular weight of 600.64 g/mol. Its IUPAC name is 6-amino-9-benzyl-2-(2-hydroxyethylamino)-7H-purin-8-one.
| Compound Name | 6-amino-9-benzyl-2-(2-hydroxyethylamino)-7H-purin-8-one |
|---|---|
| PubChem CID | 160881281 |
| Molecular Formula | C28H32N12O4 |
| Molecular Weight | 600.64 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | 6-amino-9-benzyl-2-(2-hydroxyethylamino)-7H-purin-8-one |
| SMILES | Nc1nc(NCCO)nc2c1[nH]c(=O)n2Cc1ccccc1.Nc1nc(NCCO)nc2c1[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/2C14H16N6O2/c2*15-11-10-12(19-13(18-11)16-6-7-21)20(14(22)17-10)8-9-4-2-1-3-5-9/h2*1-5,21H,6-8H2,(H,17,22)(H3,15,16,18,19) |
| InChIKey | SNBFSGYRBXMSLQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 243.70 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.64 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |