C15H16N6O2 — CID 11977604
6-amino-9-benzyl-N-ethyl-8-oxo-7H-purine-2-carboxamide (PubChem CID 11977604) has the molecular formula C15H16N6O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 6-amino-9-benzyl-N-ethyl-8-oxo-7H-purine-2-carboxamide.
| Compound Name | 6-amino-9-benzyl-N-ethyl-8-oxo-7H-purine-2-carboxamide |
|---|---|
| PubChem CID | 11977604 |
| Molecular Formula | C15H16N6O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 6-amino-9-benzyl-N-ethyl-8-oxo-7H-purine-2-carboxamide |
| SMILES | CCNC(=O)c1nc(N)c2[nH]c(=O)n(Cc3ccccc3)c2n1 |
| InChI | InChI=1S/C15H16N6O2/c1-2-17-14(22)12-19-11(16)10-13(20-12)21(15(23)18-10)8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,17,22)(H,18,23)(H2,16,19,20) |
| InChIKey | KHXXYAGASLNMNU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |