C15H19N5O3S — CID 175066439
6-amino-9-benzyl-8-oxo-7H-purine-2-sulfinic acid;propane (PubChem CID 175066439) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is 6-amino-9-benzyl-8-oxo-7H-purine-2-sulfinic acid;propane.
| Compound Name | 6-amino-9-benzyl-8-oxo-7H-purine-2-sulfinic acid;propane |
|---|---|
| PubChem CID | 175066439 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 6-amino-9-benzyl-8-oxo-7H-purine-2-sulfinic acid;propane |
| SMILES | CCC.Nc1nc(S(=O)O)nc2c1[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C12H11N5O3S.C3H8/c13-9-8-10(16-11(15-9)21(19)20)17(12(18)14-8)6-7-4-2-1-3-5-7;1-3-2/h1-5H,6H2,(H,14,18)(H,19,20)(H2,13,15,16);3H2,1-2H3 |
| InChIKey | PHHNHHQBVDILPU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|