C13H14N5O4P — CID 11771998
(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)methylphosphonic acid (PubChem CID 11771998) has the molecular formula C13H14N5O4P and a molecular weight of 335.26 g/mol. Its IUPAC name is (6-amino-9-benzyl-8-oxo-7H-purin-2-yl)methylphosphonic acid.
| Compound Name | (6-amino-9-benzyl-8-oxo-7H-purin-2-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 11771998 |
| Molecular Formula | C13H14N5O4P |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (6-amino-9-benzyl-8-oxo-7H-purin-2-yl)methylphosphonic acid |
| SMILES | Nc1nc(CP(=O)(O)O)nc2c1[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C13H14N5O4P/c14-11-10-12(16-9(15-11)7-23(20,21)22)18(13(19)17-10)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,17,19)(H2,14,15,16)(H2,20,21,22) |
| InChIKey | PLCBKYYNFOLBEZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|