C14H13N5O4 — CID 59382538
2-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)oxy]acetic acid (PubChem CID 59382538) has the molecular formula C14H13N5O4 and a molecular weight of 315.29 g/mol. Its IUPAC name is 2-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)oxy]acetic acid.
| Compound Name | 2-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 59382538 |
| Molecular Formula | C14H13N5O4 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-[(6-amino-9-benzyl-8-oxo-7H-purin-2-yl)oxy]acetic acid |
| SMILES | Nc1nc(OCC(=O)O)nc2c1[nH]c(=O)n2Cc1ccccc1 |
| InChI | InChI=1S/C14H13N5O4/c15-11-10-12(18-13(17-11)23-7-9(20)21)19(14(22)16-10)6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,16,22)(H,20,21)(H2,15,17,18) |
| InChIKey | IQAKQQAKKPURPU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |