C20H28N6O4 — CID 145310401
N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]acetamide;ethane (PubChem CID 145310401) has the molecular formula C20H28N6O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]acetamide;ethane.
| Compound Name | N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]acetamide;ethane |
|---|---|
| PubChem CID | 145310401 |
| Molecular Formula | C20H28N6O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]acetamide;ethane |
| SMILES | CC.COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CNC(C)=O)cc3)c2n1 |
| InChI | InChI=1S/C18H22N6O4.C2H6/c1-11(25)20-9-12-3-5-13(6-4-12)10-24-16-14(21-18(24)26)15(19)22-17(23-16)28-8-7-27-2;1-2/h3-6H,7-10H2,1-2H3,(H,20,25)(H,21,26)(H2,19,22,23);1-2H3 |
| InChIKey | DRJAPHPXDNERJO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|