C22H29N7O4 — CID 139570486
(E)-N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]-4-(dimethylamino)but-3-enamide (PubChem CID 139570486) has the molecular formula C22H29N7O4 and a molecular weight of 455.52 g/mol. Its IUPAC name is (E)-N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]-4-(dimethylamino)but-3-enamide.
| Compound Name | (E)-N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]-4-(dimethylamino)but-3-enamide |
|---|---|
| PubChem CID | 139570486 |
| Molecular Formula | C22H29N7O4 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | (E)-N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]-4-(dimethylamino)but-3-enamide |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CNC(=O)C/C=C/N(C)C)cc3)c2n1 |
| InChI | InChI=1S/C22H29N7O4/c1-28(2)10-4-5-17(30)24-13-15-6-8-16(9-7-15)14-29-20-18(25-22(29)31)19(23)26-21(27-20)33-12-11-32-3/h4,6-10H,5,11-14H2,1-3H3,(H,24,30)(H,25,31)(H2,23,26,27)/b10-4+ |
| InChIKey | DXHIUKHALAGDBI-ONNFQVAWSA-N |
| XLogP | 0.86 |
| TPSA | 140.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|