C25H29N7O8 — CID 139570583
(2,5-dioxopyrrolidin-1-yl) 5-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methylamino]-5-oxopentanoate (PubChem CID 139570583) has the molecular formula C25H29N7O8 and a molecular weight of 555.55 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 5-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methylamino]-5-oxopentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 5-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 139570583 |
| Molecular Formula | C25H29N7O8 |
| Molecular Weight | 555.55 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 5-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methylamino]-5-oxopentanoate |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CNC(=O)CCCC(=O)ON4C(=O)CCC4=O)cc3)c2n1 |
| InChI | InChI=1S/C25H29N7O8/c1-38-11-12-39-24-29-22(26)21-23(30-24)31(25(37)28-21)14-16-7-5-15(6-8-16)13-27-17(33)3-2-4-20(36)40-32-18(34)9-10-19(32)35/h5-8H,2-4,9-14H2,1H3,(H,27,33)(H,28,37)(H2,26,29,30) |
| InChIKey | ORMDRLRGGHUODK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 200.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.55 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|