C21H26N6O5 — CID 157102946
N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]-4-oxopentanamide (PubChem CID 157102946) has the molecular formula C21H26N6O5 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]-4-oxopentanamide.
| Compound Name | N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]-4-oxopentanamide |
|---|---|
| PubChem CID | 157102946 |
| Molecular Formula | C21H26N6O5 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]methyl]-4-oxopentanamide |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CNC(=O)CCC(C)=O)cc3)c2n1 |
| InChI | InChI=1S/C21H26N6O5/c1-13(28)3-8-16(29)23-11-14-4-6-15(7-5-14)12-27-19-17(24-21(27)30)18(22)25-20(26-19)32-10-9-31-2/h4-7H,3,8-12H2,1-2H3,(H,23,29)(H,24,30)(H2,22,25,26) |
| InChIKey | WTBIDUWZFFYLJI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 154.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|