C18H23N7O3 — CID 118428813
6-amino-9-[[4-[(1-aminoethenylamino)methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one (PubChem CID 118428813) has the molecular formula C18H23N7O3 and a molecular weight of 385.43 g/mol. Its IUPAC name is 6-amino-9-[[4-[(1-aminoethenylamino)methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one.
| Compound Name | 6-amino-9-[[4-[(1-aminoethenylamino)methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one |
|---|---|
| PubChem CID | 118428813 |
| Molecular Formula | C18H23N7O3 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 6-amino-9-[[4-[(1-aminoethenylamino)methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one |
| SMILES | C=C(N)NCc1ccc(Cn2c(=O)[nH]c3c(N)nc(OCCOC)nc32)cc1 |
| InChI | InChI=1S/C18H23N7O3/c1-11(19)21-9-12-3-5-13(6-4-12)10-25-16-14(22-18(25)26)15(20)23-17(24-16)28-8-7-27-2/h3-6,21H,1,7-10,19H2,2H3,(H,22,26)(H2,20,23,24) |
| InChIKey | JWCZPXCAQGEUGL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|