C22H26N8O3 — CID 146320067
6-amino-9-[[4-[[(2-amino-4-pyridinyl)methylamino]methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one (PubChem CID 146320067) has the molecular formula C22H26N8O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is 6-amino-9-[[4-[[(2-amino-4-pyridinyl)methylamino]methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one.
| Compound Name | 6-amino-9-[[4-[[(2-amino-4-pyridinyl)methylamino]methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one |
|---|---|
| PubChem CID | 146320067 |
| Molecular Formula | C22H26N8O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 6-amino-9-[[4-[[(2-amino-4-pyridinyl)methylamino]methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CNCc4ccnc(N)c4)cc3)c2n1 |
| InChI | InChI=1S/C22H26N8O3/c1-32-8-9-33-21-28-19(24)18-20(29-21)30(22(31)27-18)13-15-4-2-14(3-5-15)11-25-12-16-6-7-26-17(23)10-16/h2-7,10,25H,8-9,11-13H2,1H3,(H2,23,26)(H,27,31)(H2,24,28,29) |
| InChIKey | AEPOXTDDWINABA-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 158.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|