C49H86N6O3 — CID 135284362
6-amino-9-[[4-[[4,8,12,17,21,25-hexamethylhexacosyl(methyl)amino]methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one (PubChem CID 135284362) has the molecular formula C49H86N6O3 and a molecular weight of 807.27 g/mol. Its IUPAC name is 6-amino-9-[[4-[[4,8,12,17,21,25-hexamethylhexacosyl(methyl)amino]methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one.
| Compound Name | 6-amino-9-[[4-[[4,8,12,17,21,25-hexamethylhexacosyl(methyl)amino]methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one |
|---|---|
| PubChem CID | 135284362 |
| Molecular Formula | C49H86N6O3 |
| Molecular Weight | 807.27 g/mol |
| Exact Mass | 806.68 |
| IUPAC Name | 6-amino-9-[[4-[[4,8,12,17,21,25-hexamethylhexacosyl(methyl)amino]methyl]phenyl]methyl]-2-(2-methoxyethoxy)-7H-purin-8-one |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CN(C)CCCC(C)CCCC(C)CCCC(C)CCCCC(C)CCCC(C)CCCC(C)C)cc3)c2n1 |
| InChI | InChI=1S/C49H86N6O3/c1-37(2)17-12-20-40(5)23-13-21-38(3)18-10-11-19-39(4)22-14-24-41(6)25-15-26-42(7)27-16-32-54(8)35-43-28-30-44(31-29-43)36-55-47-45(51-49(55)56)46(50)52-48(53-47)58-34-33-57-9/h28-31,37-42H,10-27,32-36H2,1-9H3,(H,51,56)(H2,50,52,53) |
| InChIKey | VOINJWOWZIPQIO-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.27 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|