C23H32N8O4 — CID 146308283
4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide (PubChem CID 146308283) has the molecular formula C23H32N8O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide.
| Compound Name | 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 146308283 |
| Molecular Formula | C23H32N8O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]-N-[2-(4-methylpiperazin-1-yl)ethyl]benzamide |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(C(=O)NCCN4CCN(C)CC4)cc3)c2n1 |
| InChI | InChI=1S/C23H32N8O4/c1-29-9-11-30(12-10-29)8-7-25-21(32)17-5-3-16(4-6-17)15-31-20-18(26-23(31)33)19(24)27-22(28-20)35-14-13-34-2/h3-6H,7-15H2,1-2H3,(H,25,32)(H,26,33)(H2,24,27,28) |
| InChIKey | IUAQJQRWOVNMDF-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|