C20H20N6O7 — CID 91573040
(2,5-dihydroxypyrrol-1-yl) 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoate (PubChem CID 91573040) has the molecular formula C20H20N6O7 and a molecular weight of 456.42 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoate |
|---|---|
| PubChem CID | 91573040 |
| Molecular Formula | C20H20N6O7 |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]benzoate |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(C(=O)On4c(O)ccc4O)cc3)c2n1 |
| InChI | InChI=1S/C20H20N6O7/c1-31-8-9-32-19-23-16(21)15-17(24-19)25(20(30)22-15)10-11-2-4-12(5-3-11)18(29)33-26-13(27)6-7-14(26)28/h2-7,27-28H,8-10H2,1H3,(H,22,30)(H2,21,23,24) |
| InChIKey | PHHZLKNTFGJGSE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 179.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|