C25H28N6O8 — CID 157050086
(2,5-dioxopyrrolidin-1-yl) 6-[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-4-oxohexanoate (PubChem CID 157050086) has the molecular formula C25H28N6O8 and a molecular weight of 540.53 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-4-oxohexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-4-oxohexanoate |
|---|---|
| PubChem CID | 157050086 |
| Molecular Formula | C25H28N6O8 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-4-oxohexanoate |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CCC(=O)CCC(=O)ON4C(=O)CCC4=O)cc3)c2n1 |
| InChI | InChI=1S/C25H28N6O8/c1-37-12-13-38-24-28-22(26)21-23(29-24)30(25(36)27-21)14-16-4-2-15(3-5-16)6-7-17(32)8-11-20(35)39-31-18(33)9-10-19(31)34/h2-5H,6-14H2,1H3,(H,27,36)(H2,26,28,29) |
| InChIKey | WLFCRNCXKXHIJW-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 188.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|