C29H36N6O7 — CID 158112993
2-[[6-[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-4-oxohexanoyl]amino]oct-7-ynoic acid (PubChem CID 158112993) has the molecular formula C29H36N6O7 and a molecular weight of 580.64 g/mol. Its IUPAC name is 2-[[6-[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-4-oxohexanoyl]amino]oct-7-ynoic acid.
| Compound Name | 2-[[6-[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-4-oxohexanoyl]amino]oct-7-ynoic acid |
|---|---|
| PubChem CID | 158112993 |
| Molecular Formula | C29H36N6O7 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | 2-[[6-[4-[[6-amino-2-(2-methoxyethoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-4-oxohexanoyl]amino]oct-7-ynoic acid |
| SMILES | C#CCCCCC(NC(=O)CCC(=O)CCc1ccc(Cn2c(=O)[nH]c3c(N)nc(OCCOC)nc32)cc1)C(=O)O |
| InChI | InChI=1S/C29H36N6O7/c1-3-4-5-6-7-22(27(38)39)31-23(37)15-14-21(36)13-12-19-8-10-20(11-9-19)18-35-26-24(32-29(35)40)25(30)33-28(34-26)42-17-16-41-2/h1,8-11,22H,4-7,12-18H2,2H3,(H,31,37)(H,32,40)(H,38,39)(H2,30,33,34) |
| InChIKey | FUVKRLLQSLCTPN-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 191.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|