C30H42N6O7S — CID 157248428
10-[4-[[6-amino-2-(3-hydroxypropoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-sulfanylidenedecanoic acid (PubChem CID 157248428) has the molecular formula C30H42N6O7S and a molecular weight of 630.77 g/mol. Its IUPAC name is 10-[4-[[6-amino-2-(3-hydroxypropoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-sulfanylidenedecanoic acid.
| Compound Name | 10-[4-[[6-amino-2-(3-hydroxypropoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-sulfanylidenedecanoic acid |
|---|---|
| PubChem CID | 157248428 |
| Molecular Formula | C30H42N6O7S |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.28 |
| IUPAC Name | 10-[4-[[6-amino-2-(3-hydroxypropoxy)-8-oxo-7H-purin-9-yl]methyl]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-8-sulfanylidenedecanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCCCCC(=S)CCc1ccc(Cn2c(=O)[nH]c3c(N)nc(OCCCO)nc32)cc1)C(=O)O |
| InChI | InChI=1S/C30H42N6O7S/c1-30(2,3)43-29(41)32-22(26(38)39)9-6-4-5-8-21(44)15-14-19-10-12-20(13-11-19)18-36-25-23(33-28(36)40)24(31)34-27(35-25)42-17-7-16-37/h10-13,22,37H,4-9,14-18H2,1-3H3,(H,32,41)(H,33,40)(H,38,39)(H2,31,34,35) |
| InChIKey | ZMZRTIQEUWSVOM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 194.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|