C15H17Cl2N5O2 — CID 66921112
6-amino-9-[[4-(chloromethyl)phenyl]methyl]-2-ethoxy-7H-purin-8-one;hydrochloride (PubChem CID 66921112) has the molecular formula C15H17Cl2N5O2 and a molecular weight of 370.24 g/mol. Its IUPAC name is 6-amino-9-[[4-(chloromethyl)phenyl]methyl]-2-ethoxy-7H-purin-8-one;hydrochloride.
| Compound Name | 6-amino-9-[[4-(chloromethyl)phenyl]methyl]-2-ethoxy-7H-purin-8-one;hydrochloride |
|---|---|
| PubChem CID | 66921112 |
| Molecular Formula | C15H17Cl2N5O2 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 6-amino-9-[[4-(chloromethyl)phenyl]methyl]-2-ethoxy-7H-purin-8-one;hydrochloride |
| SMILES | CCOc1nc(N)c2[nH]c(=O)n(Cc3ccc(CCl)cc3)c2n1.Cl |
| InChI | InChI=1S/C15H16ClN5O2.ClH/c1-2-23-14-19-12(17)11-13(20-14)21(15(22)18-11)8-10-5-3-9(7-16)4-6-10;/h3-6H,2,7-8H2,1H3,(H,18,22)(H2,17,19,20);1H |
| InChIKey | BBLJUGBZHWCCRB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|