C14H17N5O2 — CID 147379924
6-amino-9-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethoxy-7H-purin-8-one (PubChem CID 147379924) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 6-amino-9-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethoxy-7H-purin-8-one.
| Compound Name | 6-amino-9-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethoxy-7H-purin-8-one |
|---|---|
| PubChem CID | 147379924 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 6-amino-9-(cyclohexa-1,5-dien-1-ylmethyl)-2-ethoxy-7H-purin-8-one |
| SMILES | CCOc1nc(N)c2[nH]c(=O)n(CC3=CCCC=C3)c2n1 |
| InChI | InChI=1S/C14H17N5O2/c1-2-21-13-17-11(15)10-12(18-13)19(14(20)16-10)8-9-6-4-3-5-7-9/h4,6-7H,2-3,5,8H2,1H3,(H,16,20)(H2,15,17,18) |
| InChIKey | DKTRJTOIBWENAJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |