C19H27N5O4 — CID 143113079
6-amino-2-(2-ethoxyethoxy)-9-[[3-(2-methoxyethyl)cyclohexa-2,4-dien-1-yl]methyl]-7H-purin-8-one (PubChem CID 143113079) has the molecular formula C19H27N5O4 and a molecular weight of 389.46 g/mol. Its IUPAC name is 6-amino-2-(2-ethoxyethoxy)-9-[[3-(2-methoxyethyl)cyclohexa-2,4-dien-1-yl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-(2-ethoxyethoxy)-9-[[3-(2-methoxyethyl)cyclohexa-2,4-dien-1-yl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 143113079 |
| Molecular Formula | C19H27N5O4 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 6-amino-2-(2-ethoxyethoxy)-9-[[3-(2-methoxyethyl)cyclohexa-2,4-dien-1-yl]methyl]-7H-purin-8-one |
| SMILES | CCOCCOc1nc(N)c2[nH]c(=O)n(CC3C=C(CCOC)C=CC3)c2n1 |
| InChI | InChI=1S/C19H27N5O4/c1-3-27-9-10-28-18-22-16(20)15-17(23-18)24(19(25)21-15)12-14-6-4-5-13(11-14)7-8-26-2/h4-5,11,14H,3,6-10,12H2,1-2H3,(H,21,25)(H2,20,22,23) |
| InChIKey | RVFCOMKZHQTWKE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|