C15H24N6O3 — CID 143428583
6-amino-2-(2-methoxyethoxy)-9-(2-piperidin-4-ylethyl)-7H-purin-8-one (PubChem CID 143428583) has the molecular formula C15H24N6O3 and a molecular weight of 336.40 g/mol. Its IUPAC name is 6-amino-2-(2-methoxyethoxy)-9-(2-piperidin-4-ylethyl)-7H-purin-8-one.
| Compound Name | 6-amino-2-(2-methoxyethoxy)-9-(2-piperidin-4-ylethyl)-7H-purin-8-one |
|---|---|
| PubChem CID | 143428583 |
| Molecular Formula | C15H24N6O3 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 6-amino-2-(2-methoxyethoxy)-9-(2-piperidin-4-ylethyl)-7H-purin-8-one |
| SMILES | COCCOc1nc(N)c2[nH]c(=O)n(CCC3CCNCC3)c2n1 |
| InChI | InChI=1S/C15H24N6O3/c1-23-8-9-24-14-19-12(16)11-13(20-14)21(15(22)18-11)7-4-10-2-5-17-6-3-10/h10,17H,2-9H2,1H3,(H,18,22)(H2,16,19,20) |
| InChIKey | ITCICUBYOSHMJL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|