C17H28N6O2 — CID 129302037
2-butoxy-6-(methylamino)-9-(2-piperidin-4-ylethyl)-7H-purin-8-one (PubChem CID 129302037) has the molecular formula C17H28N6O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-butoxy-6-(methylamino)-9-(2-piperidin-4-ylethyl)-7H-purin-8-one.
| Compound Name | 2-butoxy-6-(methylamino)-9-(2-piperidin-4-ylethyl)-7H-purin-8-one |
|---|---|
| PubChem CID | 129302037 |
| Molecular Formula | C17H28N6O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-butoxy-6-(methylamino)-9-(2-piperidin-4-ylethyl)-7H-purin-8-one |
| SMILES | CCCCOc1nc(NC)c2[nH]c(=O)n(CCC3CCNCC3)c2n1 |
| InChI | InChI=1S/C17H28N6O2/c1-3-4-11-25-16-21-14(18-2)13-15(22-16)23(17(24)20-13)10-7-12-5-8-19-9-6-12/h12,19H,3-11H2,1-2H3,(H,20,24)(H,18,21,22) |
| InChIKey | OTCJJRDNUZXBNR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|