C24H40N6O2 — CID 67233837
6-amino-2-butoxy-9-[2-[1-(2-cyclohexylethyl)piperidin-3-yl]ethyl]-7H-purin-8-one (PubChem CID 67233837) has the molecular formula C24H40N6O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[2-[1-(2-cyclohexylethyl)piperidin-3-yl]ethyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[2-[1-(2-cyclohexylethyl)piperidin-3-yl]ethyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 67233837 |
| Molecular Formula | C24H40N6O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 6-amino-2-butoxy-9-[2-[1-(2-cyclohexylethyl)piperidin-3-yl]ethyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCC3CCCN(CCC4CCCCC4)C3)c2n1 |
| InChI | InChI=1S/C24H40N6O2/c1-2-3-16-32-23-27-21(25)20-22(28-23)30(24(31)26-20)15-12-19-10-7-13-29(17-19)14-11-18-8-5-4-6-9-18/h18-19H,2-17H2,1H3,(H,26,31)(H2,25,27,28) |
| InChIKey | GLJRPAAPUMNMQO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|