C16H22N6O4 — CID 25072080
1-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl]pyrrolidine-2,5-dione (PubChem CID 25072080) has the molecular formula C16H22N6O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 1-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 25072080 |
| Molecular Formula | C16H22N6O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl]pyrrolidine-2,5-dione |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCN3C(=O)CCC3=O)c2n1 |
| InChI | InChI=1S/C16H22N6O4/c1-2-3-9-26-15-19-13(17)12-14(20-15)22(16(25)18-12)8-4-7-21-10(23)5-6-11(21)24/h2-9H2,1H3,(H,18,25)(H2,17,19,20) |
| InChIKey | JVOHICCBACWOOI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|