C22H38N6O2 — CID 67234171
6-amino-2-butoxy-9-[3-[1-(3-methylbutyl)piperidin-3-yl]propyl]-7H-purin-8-one (PubChem CID 67234171) has the molecular formula C22H38N6O2 and a molecular weight of 418.59 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[3-[1-(3-methylbutyl)piperidin-3-yl]propyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[3-[1-(3-methylbutyl)piperidin-3-yl]propyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 67234171 |
| Molecular Formula | C22H38N6O2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | 6-amino-2-butoxy-9-[3-[1-(3-methylbutyl)piperidin-3-yl]propyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCC3CCCN(CCC(C)C)C3)c2n1 |
| InChI | InChI=1S/C22H38N6O2/c1-4-5-14-30-21-25-19(23)18-20(26-21)28(22(29)24-18)12-7-9-17-8-6-11-27(15-17)13-10-16(2)3/h16-17H,4-15H2,1-3H3,(H,24,29)(H2,23,25,26) |
| InChIKey | UKVJPESMSIZCRN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|