C20H31N5O4 — CID 169281146
3-[1-[2-(2-butoxy-6-methyl-8-oxo-7H-purin-9-yl)ethyl]piperidin-4-yl]propanoic acid (PubChem CID 169281146) has the molecular formula C20H31N5O4 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-[1-[2-(2-butoxy-6-methyl-8-oxo-7H-purin-9-yl)ethyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[2-(2-butoxy-6-methyl-8-oxo-7H-purin-9-yl)ethyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 169281146 |
| Molecular Formula | C20H31N5O4 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 3-[1-[2-(2-butoxy-6-methyl-8-oxo-7H-purin-9-yl)ethyl]piperidin-4-yl]propanoic acid |
| SMILES | CCCCOc1nc(C)c2[nH]c(=O)n(CCN3CCC(CCC(=O)O)CC3)c2n1 |
| InChI | InChI=1S/C20H31N5O4/c1-3-4-13-29-19-21-14(2)17-18(23-19)25(20(28)22-17)12-11-24-9-7-15(8-10-24)5-6-16(26)27/h15H,3-13H2,1-2H3,(H,22,28)(H,26,27) |
| InChIKey | ZXPOQFHBWWDJAH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|