C20H31N5O5 — CID 170151839
1-[5-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)pentyl]piperidine-4-carboxylic acid (PubChem CID 170151839) has the molecular formula C20H31N5O5 and a molecular weight of 421.50 g/mol. Its IUPAC name is 1-[5-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)pentyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[5-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)pentyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 170151839 |
| Molecular Formula | C20H31N5O5 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 1-[5-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)pentyl]piperidine-4-carboxylic acid |
| SMILES | CCCCOc1nc2c([nH]c(=O)n2CCCCCN2CCC(C(=O)O)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H31N5O5/c1-2-3-13-30-19-22-16-15(17(26)23-19)21-20(29)25(16)10-6-4-5-9-24-11-7-14(8-12-24)18(27)28/h14H,2-13H2,1H3,(H,21,29)(H,27,28)(H,22,23,26) |
| InChIKey | VQJGBOPBNKVGHN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|