C22H35N5O5 — CID 170151858
methyl 2-[1-[5-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)pentyl]piperidin-3-yl]acetate (PubChem CID 170151858) has the molecular formula C22H35N5O5 and a molecular weight of 449.55 g/mol. Its IUPAC name is methyl 2-[1-[5-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)pentyl]piperidin-3-yl]acetate.
| Compound Name | methyl 2-[1-[5-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)pentyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 170151858 |
| Molecular Formula | C22H35N5O5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | methyl 2-[1-[5-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)pentyl]piperidin-3-yl]acetate |
| SMILES | CCCCOc1nc2c([nH]c(=O)n2CCCCCN2CCCC(CC(=O)OC)C2)c(=O)[nH]1 |
| InChI | InChI=1S/C22H35N5O5/c1-3-4-13-32-21-24-19-18(20(29)25-21)23-22(30)27(19)12-7-5-6-10-26-11-8-9-16(15-26)14-17(28)31-2/h16H,3-15H2,1-2H3,(H,23,30)(H,24,25,29) |
| InChIKey | UAKLOMAHMMYHRL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|