C19H29N5O5 — CID 170151844
1-[4-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)butyl]piperidine-4-carboxylic acid (PubChem CID 170151844) has the molecular formula C19H29N5O5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-[4-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)butyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)butyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 170151844 |
| Molecular Formula | C19H29N5O5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-[4-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)butyl]piperidine-4-carboxylic acid |
| SMILES | CCCCOc1nc2c([nH]c(=O)n2CCCCN2CCC(C(=O)O)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H29N5O5/c1-2-3-12-29-18-21-15-14(16(25)22-18)20-19(28)24(15)9-5-4-8-23-10-6-13(7-11-23)17(26)27/h13H,2-12H2,1H3,(H,20,28)(H,26,27)(H,21,22,25) |
| InChIKey | KAFOSLBYNYAWQY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|