C21H36N6O4 — CID 154555448
methyl 1-[4-(6-amino-2-butoxy-1-methyl-8-oxo-6,7-dihydropurin-9-yl)butyl]piperidine-4-carboxylate (PubChem CID 154555448) has the molecular formula C21H36N6O4 and a molecular weight of 436.56 g/mol. Its IUPAC name is methyl 1-[4-(6-amino-2-butoxy-1-methyl-8-oxo-6,7-dihydropurin-9-yl)butyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[4-(6-amino-2-butoxy-1-methyl-8-oxo-6,7-dihydropurin-9-yl)butyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 154555448 |
| Molecular Formula | C21H36N6O4 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | methyl 1-[4-(6-amino-2-butoxy-1-methyl-8-oxo-6,7-dihydropurin-9-yl)butyl]piperidine-4-carboxylate |
| SMILES | CCCCOC1=Nc2c([nH]c(=O)n2CCCCN2CCC(C(=O)OC)CC2)C(N)N1C |
| InChI | InChI=1S/C21H36N6O4/c1-4-5-14-31-21-24-18-16(17(22)25(21)2)23-20(29)27(18)11-7-6-10-26-12-8-15(9-13-26)19(28)30-3/h15,17H,4-14,22H2,1-3H3,(H,23,29) |
| InChIKey | PZVVLNOQNNPJJZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|