C24H34N8O4 — CID 69099813
2-[3-[[[4-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]piperazin-1-yl]amino]methyl]phenyl]acetic acid (PubChem CID 69099813) has the molecular formula C24H34N8O4 and a molecular weight of 498.59 g/mol. Its IUPAC name is 2-[3-[[[4-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]piperazin-1-yl]amino]methyl]phenyl]acetic acid.
| Compound Name | 2-[3-[[[4-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]piperazin-1-yl]amino]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 69099813 |
| Molecular Formula | C24H34N8O4 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 2-[3-[[[4-[2-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]piperazin-1-yl]amino]methyl]phenyl]acetic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCN3CCN(NCc4cccc(CC(=O)O)c4)CC3)c2n1 |
| InChI | InChI=1S/C24H34N8O4/c1-2-3-13-36-23-28-21(25)20-22(29-23)32(24(35)27-20)12-9-30-7-10-31(11-8-30)26-16-18-6-4-5-17(14-18)15-19(33)34/h4-6,14,26H,2-3,7-13,15-16H2,1H3,(H,27,35)(H,33,34)(H2,25,28,29) |
| InChIKey | YBCWQLJDYWBXOW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 154.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|