C26H35N7O5 — CID 69100042
2-[3-[[2-[4-[1-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]piperidin-1-yl]acetyl]amino]phenyl]acetic acid (PubChem CID 69100042) has the molecular formula C26H35N7O5 and a molecular weight of 525.61 g/mol. Its IUPAC name is 2-[3-[[2-[4-[1-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]piperidin-1-yl]acetyl]amino]phenyl]acetic acid.
| Compound Name | 2-[3-[[2-[4-[1-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]piperidin-1-yl]acetyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 69100042 |
| Molecular Formula | C26H35N7O5 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | 2-[3-[[2-[4-[1-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)ethyl]piperidin-1-yl]acetyl]amino]phenyl]acetic acid |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(C(C)C3CCN(CC(=O)Nc4cccc(CC(=O)O)c4)CC3)c2n1 |
| InChI | InChI=1S/C26H35N7O5/c1-3-4-12-38-25-30-23(27)22-24(31-25)33(26(37)29-22)16(2)18-8-10-32(11-9-18)15-20(34)28-19-7-5-6-17(13-19)14-21(35)36/h5-7,13,16,18H,3-4,8-12,14-15H2,1-2H3,(H,28,34)(H,29,37)(H,35,36)(H2,27,30,31) |
| InChIKey | ZQBHTIDIWFULGG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 168.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|