C30H43N7O5 — CID 11706932
methyl 2-[3-[[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]phenyl]acetate (PubChem CID 11706932) has the molecular formula C30H43N7O5 and a molecular weight of 581.72 g/mol. Its IUPAC name is methyl 2-[3-[[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]phenyl]acetate |
|---|---|
| PubChem CID | 11706932 |
| Molecular Formula | C30H43N7O5 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.33 |
| IUPAC Name | methyl 2-[3-[[4-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)butyl-[3-(2-oxopyrrolidin-1-yl)propyl]amino]methyl]phenyl]acetate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCCN(CCCN3CCCC3=O)Cc3cccc(CC(=O)OC)c3)c2n1 |
| InChI | InChI=1S/C30H43N7O5/c1-3-4-18-42-29-33-27(31)26-28(34-29)37(30(40)32-26)17-6-5-13-35(14-9-16-36-15-8-12-24(36)38)21-23-11-7-10-22(19-23)20-25(39)41-2/h7,10-11,19H,3-6,8-9,12-18,20-21H2,1-2H3,(H,32,40)(H2,31,33,34) |
| InChIKey | LZLGGPCPLJYPND-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|