C30H42N6O7 — CID 24962064
tert-butyl 4-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[[3-(2-methoxy-2-oxoethyl)phenyl]methyl]amino]-4-oxobutanoate (PubChem CID 24962064) has the molecular formula C30H42N6O7 and a molecular weight of 598.70 g/mol. Its IUPAC name is tert-butyl 4-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[[3-(2-methoxy-2-oxoethyl)phenyl]methyl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[[3-(2-methoxy-2-oxoethyl)phenyl]methyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 24962064 |
| Molecular Formula | C30H42N6O7 |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | tert-butyl 4-[3-(6-amino-2-butoxy-8-oxo-7H-purin-9-yl)propyl-[[3-(2-methoxy-2-oxoethyl)phenyl]methyl]amino]-4-oxobutanoate |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(CCCN(Cc3cccc(CC(=O)OC)c3)C(=O)CCC(=O)OC(C)(C)C)c2n1 |
| InChI | InChI=1S/C30H42N6O7/c1-6-7-16-42-28-33-26(31)25-27(34-28)36(29(40)32-25)15-9-14-35(22(37)12-13-23(38)43-30(2,3)4)19-21-11-8-10-20(17-21)18-24(39)41-5/h8,10-11,17H,6-7,9,12-16,18-19H2,1-5H3,(H,32,40)(H2,31,33,34) |
| InChIKey | MOUHSBWCZXGXLU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 171.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|